C9H8Cl2N4S — CID 535621
N'-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-N,N-dimethylmethanimidamide (PubChem CID 535621) has the molecular formula C9H8Cl2N4S and a molecular weight of 275.16 g/mol. Its IUPAC name is N'-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 535621 |
| Molecular Formula | C9H8Cl2N4S |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | N'-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1c(Cl)cc(Cl)c2nsnc12 |
| InChI | InChI=1S/C9H8Cl2N4S/c1-15(2)4-12-7-5(10)3-6(11)8-9(7)14-16-13-8/h3-4H,1-2H3/b12-4+ |
| InChIKey | WVZNXCMYZFSVBM-UUILKARUSA-N |
| XLogP | 3.22 |
| TPSA | 41.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|