C7H5N3S — CID 5382377
1H-pyrido[2,3-d]pyrimidine-4-thione (PubChem CID 5382377) has the molecular formula C7H5N3S and a molecular weight of 163.21 g/mol. Its IUPAC name is 1H-pyrido[2,3-d]pyrimidine-4-thione.
| Compound Name | 1H-pyrido[2,3-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 5382377 |
| Molecular Formula | C7H5N3S |
| Molecular Weight | 163.21 g/mol |
| Exact Mass | 163.02 |
| IUPAC Name | 1H-pyrido[2,3-d]pyrimidine-4-thione |
| SMILES | S=c1nc[nH]c2ncccc12 |
| InChI | InChI=1S/C7H5N3S/c11-7-5-2-1-3-8-6(5)9-4-10-7/h1-4H,(H,8,9,10,11) |
| InChIKey | LQDZBRVMVSRDTC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|