C13H18O9 — CID 54012993
[(3R,4S,5S)-2,3,4-triacetyl-2,4,5-trihydroxyoxan-3-yl] acetate (PubChem CID 54012993) has the molecular formula C13H18O9 and a molecular weight of 318.28 g/mol. Its IUPAC name is [(3R,4S,5S)-2,3,4-triacetyl-2,4,5-trihydroxyoxan-3-yl] acetate.
| Compound Name | [(3R,4S,5S)-2,3,4-triacetyl-2,4,5-trihydroxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 54012993 |
| Molecular Formula | C13H18O9 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | [(3R,4S,5S)-2,3,4-triacetyl-2,4,5-trihydroxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@]1(C(C)=O)C(O)(C(C)=O)OC[C@H](O)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C13H18O9/c1-6(14)11(19)10(18)5-21-13(20,8(3)16)12(11,7(2)15)22-9(4)17/h10,18-20H,5H2,1-4H3/t10-,11-,12-,13?/m0/s1 |
| InChIKey | KTRLODKYRGAYAU-TXRDPFJMSA-N |
| XLogP | -2.13 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |