C37H41N3O6 — CID 54013732
(2S)-2-[methyl-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]amino]-3-phenyl-N-(4-phenylbutyl)-N-(pyridin-4-ylmethyl)propanamide (PubChem CID 54013732) has the molecular formula C37H41N3O6 and a molecular weight of 623.75 g/mol. Its IUPAC name is (2S)-2-[methyl-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]amino]-3-phenyl-N-(4-phenylbutyl)-N-(pyridin-4-ylmethyl)propanamide.
| Compound Name | (2S)-2-[methyl-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]amino]-3-phenyl-N-(4-phenylbutyl)-N-(pyridin-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 54013732 |
| Molecular Formula | C37H41N3O6 |
| Molecular Weight | 623.75 g/mol |
| Exact Mass | 623.30 |
| IUPAC Name | (2S)-2-[methyl-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]amino]-3-phenyl-N-(4-phenylbutyl)-N-(pyridin-4-ylmethyl)propanamide |
| SMILES | COc1cc(C(=O)C(=O)N(C)[C@@H](Cc2ccccc2)C(=O)N(CCCCc2ccccc2)Cc2ccncc2)cc(OC)c1OC |
| InChI | InChI=1S/C37H41N3O6/c1-39(37(43)34(41)30-24-32(44-2)35(46-4)33(25-30)45-3)31(23-28-16-9-6-10-17-28)36(42)40(26-29-18-20-38-21-19-29)22-12-11-15-27-13-7-5-8-14-27/h5-10,13-14,16-21,24-25,31H,11-12,15,22-23,26H2,1-4H3/t31-/m0/s1 |
| InChIKey | KUDORVCRHCUBAT-HKBQPEDESA-N |
| XLogP | 5.41 |
| TPSA | 98.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.75 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|