C18H29N2+ — CID 54034706
cyanomethyl-(3,7-dimethyl-4-prop-1-en-2-ylnona-1,6,8-trien-3-yl)-dimethylazanium (PubChem CID 54034706) has the molecular formula C18H29N2+ and a molecular weight of 273.44 g/mol. Its IUPAC name is cyanomethyl-(3,7-dimethyl-4-prop-1-en-2-ylnona-1,6,8-trien-3-yl)-dimethylazanium.
| Compound Name | cyanomethyl-(3,7-dimethyl-4-prop-1-en-2-ylnona-1,6,8-trien-3-yl)-dimethylazanium |
|---|---|
| PubChem CID | 54034706 |
| Molecular Formula | C18H29N2+ |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 273.23 |
| IUPAC Name | cyanomethyl-(3,7-dimethyl-4-prop-1-en-2-ylnona-1,6,8-trien-3-yl)-dimethylazanium |
| SMILES | C=CC(C)=CCC(C(=C)C)C(C)(C=C)[N+](C)(C)CC#N |
| InChI | InChI=1S/C18H29N2/c1-9-16(5)11-12-17(15(3)4)18(6,10-2)20(7,8)14-13-19/h9-11,17H,1-3,12,14H2,4-8H3/q+1 |
| InChIKey | PIMGLLNIKNFKJJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|