C23H18F4O4S — CID 54036282
[(2S,3S)-2-(4-fluorophenyl)-3-[2-(trifluoromethyl)phenyl]oxiran-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 54036282) has the molecular formula C23H18F4O4S and a molecular weight of 466.45 g/mol. Its IUPAC name is [(2S,3S)-2-(4-fluorophenyl)-3-[2-(trifluoromethyl)phenyl]oxiran-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,3S)-2-(4-fluorophenyl)-3-[2-(trifluoromethyl)phenyl]oxiran-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 54036282 |
| Molecular Formula | C23H18F4O4S |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | [(2S,3S)-2-(4-fluorophenyl)-3-[2-(trifluoromethyl)phenyl]oxiran-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@]2(c3ccc(F)cc3)O[C@H]2c2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H18F4O4S/c1-15-6-12-18(13-7-15)32(28,29)30-14-22(16-8-10-17(24)11-9-16)21(31-22)19-4-2-3-5-20(19)23(25,26)27/h2-13,21H,14H2,1H3/t21-,22+/m0/s1 |
| InChIKey | LJEJKGZOBSGHFJ-FCHUYYIVSA-N |
| XLogP | 5.53 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|