C23H17F5O4S — CID 87554726
[(2R,3S)-2-(2,4-difluorophenyl)-3-[2-(trifluoromethyl)phenyl]oxiran-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 87554726) has the molecular formula C23H17F5O4S and a molecular weight of 484.44 g/mol. Its IUPAC name is [(2R,3S)-2-(2,4-difluorophenyl)-3-[2-(trifluoromethyl)phenyl]oxiran-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S)-2-(2,4-difluorophenyl)-3-[2-(trifluoromethyl)phenyl]oxiran-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87554726 |
| Molecular Formula | C23H17F5O4S |
| Molecular Weight | 484.44 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | [(2R,3S)-2-(2,4-difluorophenyl)-3-[2-(trifluoromethyl)phenyl]oxiran-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@]2(c3ccc(F)cc3F)O[C@H]2c2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H17F5O4S/c1-14-6-9-16(10-7-14)33(29,30)31-13-22(19-11-8-15(24)12-20(19)25)21(32-22)17-4-2-3-5-18(17)23(26,27)28/h2-12,21H,13H2,1H3/t21-,22-/m0/s1 |
| InChIKey | RHSAVZADPPEONA-VXKWHMMOSA-N |
| XLogP | 5.66 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.44 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|