C25H21FO5S — CID 58948727
[(2S,4R,6R)-17-fluoro-13-oxo-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 58948727) has the molecular formula C25H21FO5S and a molecular weight of 452.50 g/mol. Its IUPAC name is [(2S,4R,6R)-17-fluoro-13-oxo-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,4R,6R)-17-fluoro-13-oxo-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58948727 |
| Molecular Formula | C25H21FO5S |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | [(2S,4R,6R)-17-fluoro-13-oxo-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2C[C@@H]3c4ccccc4C(=O)c4ccc(F)cc4[C@H]3O2)cc1 |
| InChI | InChI=1S/C25H21FO5S/c1-15-6-9-18(10-7-15)32(28,29)30-14-17-13-23-19-4-2-3-5-20(19)24(27)21-11-8-16(26)12-22(21)25(23)31-17/h2-12,17,23,25H,13-14H2,1H3/t17-,23-,25-/m1/s1 |
| InChIKey | WCKTXNOVYRVIFC-WQWSHVPRSA-N |
| XLogP | 4.70 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|