C16H12F4O2 — CID 54488264
[(2S,3S)-2-(4-fluorophenyl)-3-[2-(trifluoromethyl)phenyl]oxiran-2-yl]methanol (PubChem CID 54488264) has the molecular formula C16H12F4O2 and a molecular weight of 312.26 g/mol. Its IUPAC name is [(2S,3S)-2-(4-fluorophenyl)-3-[2-(trifluoromethyl)phenyl]oxiran-2-yl]methanol.
| Compound Name | [(2S,3S)-2-(4-fluorophenyl)-3-[2-(trifluoromethyl)phenyl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 54488264 |
| Molecular Formula | C16H12F4O2 |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | [(2S,3S)-2-(4-fluorophenyl)-3-[2-(trifluoromethyl)phenyl]oxiran-2-yl]methanol |
| SMILES | OC[C@]1(c2ccc(F)cc2)O[C@H]1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H12F4O2/c17-11-7-5-10(6-8-11)15(9-21)14(22-15)12-3-1-2-4-13(12)16(18,19)20/h1-8,14,21H,9H2/t14-,15+/m0/s1 |
| InChIKey | XTXBJHQECGVFIT-LSDHHAIUSA-N |
| XLogP | 3.80 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|