C17H13F5O2 — CID 142784988
2-[2-(2,4-difluorophenyl)-3-[2-(trifluoromethyl)phenyl]oxiran-2-yl]ethanol (PubChem CID 142784988) has the molecular formula C17H13F5O2 and a molecular weight of 344.28 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenyl)-3-[2-(trifluoromethyl)phenyl]oxiran-2-yl]ethanol.
| Compound Name | 2-[2-(2,4-difluorophenyl)-3-[2-(trifluoromethyl)phenyl]oxiran-2-yl]ethanol |
|---|---|
| PubChem CID | 142784988 |
| Molecular Formula | C17H13F5O2 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2-[2-(2,4-difluorophenyl)-3-[2-(trifluoromethyl)phenyl]oxiran-2-yl]ethanol |
| SMILES | OCCC1(c2ccc(F)cc2F)OC1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H13F5O2/c18-10-5-6-13(14(19)9-10)16(7-8-23)15(24-16)11-3-1-2-4-12(11)17(20,21)22/h1-6,9,15,23H,7-8H2 |
| InChIKey | ARJSWSWKEKUWOJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|