C11H19F3N3O3PS — CID 54037496
2-[[bis(propylamino)-thiophosphorosomethyl]-(2,2,2-trifluoroacetyl)amino]acetic acid (PubChem CID 54037496) has the molecular formula C11H19F3N3O3PS and a molecular weight of 361.33 g/mol. Its IUPAC name is 2-[[bis(propylamino)-thiophosphorosomethyl]-(2,2,2-trifluoroacetyl)amino]acetic acid.
| Compound Name | 2-[[bis(propylamino)-thiophosphorosomethyl]-(2,2,2-trifluoroacetyl)amino]acetic acid |
|---|---|
| PubChem CID | 54037496 |
| Molecular Formula | C11H19F3N3O3PS |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 2-[[bis(propylamino)-thiophosphorosomethyl]-(2,2,2-trifluoroacetyl)amino]acetic acid |
| SMILES | CCCNC(NCCC)(P=S)N(CC(=O)O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C11H19F3N3O3PS/c1-3-5-15-11(21-22,16-6-4-2)17(7-8(18)19)9(20)10(12,13)14/h15-16H,3-7H2,1-2H3,(H,18,19) |
| InChIKey | FTHJPHDDHRPZKK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|