C25H34O4 — CID 54067760
methyl 5-[(6R)-5-hydroxy-6-[(E)-3-hydroxy-4-(4-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate (PubChem CID 54067760) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is methyl 5-[(6R)-5-hydroxy-6-[(E)-3-hydroxy-4-(4-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate.
| Compound Name | methyl 5-[(6R)-5-hydroxy-6-[(E)-3-hydroxy-4-(4-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate |
|---|---|
| PubChem CID | 54067760 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | methyl 5-[(6R)-5-hydroxy-6-[(E)-3-hydroxy-4-(4-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate |
| SMILES | COC(=O)CCCCC1=CC2CC(O)[C@H](/C=C/C(O)Cc3ccc(C)cc3)C2C1 |
| InChI | InChI=1S/C25H34O4/c1-17-7-9-18(10-8-17)14-21(26)11-12-22-23-15-19(13-20(23)16-24(22)27)5-3-4-6-25(28)29-2/h7-13,20-24,26-27H,3-6,14-16H2,1-2H3/b12-11+/t20?,21?,22-,23?,24?/m1/s1 |
| InChIKey | MEFZVMRLTMDXKI-IYORTZFISA-N |
| XLogP | 4.13 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|