C26H39NO3 — CID 21039119
(2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(E,3S)-3-hydroxy-4-(4-methoxyphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21039119) has the molecular formula C26H39NO3 and a molecular weight of 413.60 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(E,3S)-3-hydroxy-4-(4-methoxyphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(E,3S)-3-hydroxy-4-(4-methoxyphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21039119 |
| Molecular Formula | C26H39NO3 |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.29 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(E,3S)-3-hydroxy-4-(4-methoxyphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | COc1ccc(C[C@H](O)/C=C/[C@@H]2[C@H]3CC(CCCCCN(C)C)=C[C@H]3C[C@H]2O)cc1 |
| InChI | InChI=1S/C26H39NO3/c1-27(2)14-6-4-5-7-20-15-21-18-26(29)24(25(21)17-20)13-10-22(28)16-19-8-11-23(30-3)12-9-19/h8-13,15,21-22,24-26,28-29H,4-7,14,16-18H2,1-3H3/b13-10+/t21-,22+,24+,25-,26+/m0/s1 |
| InChIKey | GGNMJGKUCAKAGD-XGTFJYBHSA-N |
| XLogP | 4.22 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|