C17H29NO3Si — CID 54068483
N-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-1,3-benzodioxol-5-amine (PubChem CID 54068483) has the molecular formula C17H29NO3Si and a molecular weight of 323.51 g/mol. Its IUPAC name is N-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-1,3-benzodioxol-5-amine.
| Compound Name | N-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 54068483 |
| Molecular Formula | C17H29NO3Si |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | N-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-1,3-benzodioxol-5-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCNc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H29NO3Si/c1-17(2,3)22(4,5)21-11-7-6-10-18-14-8-9-15-16(12-14)20-13-19-15/h8-9,12,18H,6-7,10-11,13H2,1-5H3 |
| InChIKey | MESSOSZQTWKQFZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|