C26H35F3O2 — CID 54077238
2,2,2-trifluoro-1-[2-[2-[4-[4-(3-methoxyprop-1-enyl)cyclohexyl]cyclohexyl]ethyl]phenyl]ethanone (PubChem CID 54077238) has the molecular formula C26H35F3O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[2-[2-[4-[4-(3-methoxyprop-1-enyl)cyclohexyl]cyclohexyl]ethyl]phenyl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[2-[2-[4-[4-(3-methoxyprop-1-enyl)cyclohexyl]cyclohexyl]ethyl]phenyl]ethanone |
|---|---|
| PubChem CID | 54077238 |
| Molecular Formula | C26H35F3O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 2,2,2-trifluoro-1-[2-[2-[4-[4-(3-methoxyprop-1-enyl)cyclohexyl]cyclohexyl]ethyl]phenyl]ethanone |
| SMILES | COCC=CC1CCC(C2CCC(CCc3ccccc3C(=O)C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C26H35F3O2/c1-31-18-4-5-19-8-13-21(14-9-19)22-15-10-20(11-16-22)12-17-23-6-2-3-7-24(23)25(30)26(27,28)29/h2-7,19-22H,8-18H2,1H3 |
| InChIKey | MKOHCUZJSNJFPS-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|