C11H18FNO2S — CID 54085630
3-fluoro-5,10,10-trimethyl-4λ6-thia-3-azatricyclo[5.2.1.01,5]decane 4,4-dioxide (PubChem CID 54085630) has the molecular formula C11H18FNO2S and a molecular weight of 247.33 g/mol. Its IUPAC name is 3-fluoro-5,10,10-trimethyl-4λ6-thia-3-azatricyclo[5.2.1.01,5]decane 4,4-dioxide.
| Compound Name | 3-fluoro-5,10,10-trimethyl-4λ6-thia-3-azatricyclo[5.2.1.01,5]decane 4,4-dioxide |
|---|---|
| PubChem CID | 54085630 |
| Molecular Formula | C11H18FNO2S |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 3-fluoro-5,10,10-trimethyl-4λ6-thia-3-azatricyclo[5.2.1.01,5]decane 4,4-dioxide |
| SMILES | CC1(C)C2CCC13CN(F)S(=O)(=O)C3(C)C2 |
| InChI | InChI=1S/C11H18FNO2S/c1-9(2)8-4-5-11(9)7-13(12)16(14,15)10(11,3)6-8/h8H,4-7H2,1-3H3 |
| InChIKey | MQGFBSIISRLXFO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|