C22H38O6 — CID 54099121
7-[8-(3-hydroxy-6-methoxy-3-methylhex-1-enyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid (PubChem CID 54099121) has the molecular formula C22H38O6 and a molecular weight of 398.54 g/mol. Its IUPAC name is 7-[8-(3-hydroxy-6-methoxy-3-methylhex-1-enyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid.
| Compound Name | 7-[8-(3-hydroxy-6-methoxy-3-methylhex-1-enyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid |
|---|---|
| PubChem CID | 54099121 |
| Molecular Formula | C22H38O6 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 7-[8-(3-hydroxy-6-methoxy-3-methylhex-1-enyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid |
| SMILES | COCCCC(C)(O)C=CC1CCC2(OCCO2)C1CCCCCCC(=O)O |
| InChI | InChI=1S/C22H38O6/c1-21(25,12-7-15-26-2)13-10-18-11-14-22(27-16-17-28-22)19(18)8-5-3-4-6-9-20(23)24/h10,13,18-19,25H,3-9,11-12,14-17H2,1-2H3,(H,23,24) |
| InChIKey | MZHJOINWRXTYPV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|