C22H30F3NO2 — CID 54106303
N-(2-methylbutyl)-9-[[3-(trifluoromethyl)phenyl]methoxy]nona-2,4-dienamide (PubChem CID 54106303) has the molecular formula C22H30F3NO2 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-(2-methylbutyl)-9-[[3-(trifluoromethyl)phenyl]methoxy]nona-2,4-dienamide.
| Compound Name | N-(2-methylbutyl)-9-[[3-(trifluoromethyl)phenyl]methoxy]nona-2,4-dienamide |
|---|---|
| PubChem CID | 54106303 |
| Molecular Formula | C22H30F3NO2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | N-(2-methylbutyl)-9-[[3-(trifluoromethyl)phenyl]methoxy]nona-2,4-dienamide |
| SMILES | CCC(C)CNC(=O)C=CC=CCCCCOCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H30F3NO2/c1-3-18(2)16-26-21(27)13-8-6-4-5-7-9-14-28-17-19-11-10-12-20(15-19)22(23,24)25/h4,6,8,10-13,15,18H,3,5,7,9,14,16-17H2,1-2H3,(H,26,27) |
| InChIKey | NDZORVSBAOFMEX-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|