C49H51F3N4O5 — CID 54123082
5-methoxy-2-[4-[4-(2-methylbutyl)phenoxy]phenyl]pyrimidine;1-[4-[4-(5-methoxypyrimidin-2-yl)benzoyl]phenyl]-2-(trifluoromethyl)octan-1-one (PubChem CID 54123082) has the molecular formula C49H51F3N4O5 and a molecular weight of 832.96 g/mol. Its IUPAC name is 5-methoxy-2-[4-[4-(2-methylbutyl)phenoxy]phenyl]pyrimidine;1-[4-[4-(5-methoxypyrimidin-2-yl)benzoyl]phenyl]-2-(trifluoromethyl)octan-1-one.
| Compound Name | 5-methoxy-2-[4-[4-(2-methylbutyl)phenoxy]phenyl]pyrimidine;1-[4-[4-(5-methoxypyrimidin-2-yl)benzoyl]phenyl]-2-(trifluoromethyl)octan-1-one |
|---|---|
| PubChem CID | 54123082 |
| Molecular Formula | C49H51F3N4O5 |
| Molecular Weight | 832.96 g/mol |
| Exact Mass | 832.38 |
| IUPAC Name | 5-methoxy-2-[4-[4-(2-methylbutyl)phenoxy]phenyl]pyrimidine;1-[4-[4-(5-methoxypyrimidin-2-yl)benzoyl]phenyl]-2-(trifluoromethyl)octan-1-one |
| SMILES | CCC(C)Cc1ccc(Oc2ccc(-c3ncc(OC)cn3)cc2)cc1.CCCCCCC(C(=O)c1ccc(C(=O)c2ccc(-c3ncc(OC)cn3)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C27H27F3N2O3.C22H24N2O2/c1-3-4-5-6-7-23(27(28,29)30)25(34)20-10-8-18(9-11-20)24(33)19-12-14-21(15-13-19)26-31-16-22(35-2)17-32-26;1-4-16(2)13-17-5-9-19(10-6-17)26-20-11-7-18(8-12-20)22-23-14-21(25-3)15-24-22/h8-17,23H,3-7H2,1-2H3;5-12,14-16H,4,13H2,1-3H3 |
| InChIKey | NPBSYCOSVCMUMW-UHFFFAOYSA-N |
| XLogP | 12.25 |
| TPSA | 113.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.96 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|