C21H28O5 — CID 54125558
benzyl 6-[(7R)-8-hydroxy-1,4-dioxaspiro[4.5]decan-7-yl]hex-4-enoate (PubChem CID 54125558) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is benzyl 6-[(7R)-8-hydroxy-1,4-dioxaspiro[4.5]decan-7-yl]hex-4-enoate.
| Compound Name | benzyl 6-[(7R)-8-hydroxy-1,4-dioxaspiro[4.5]decan-7-yl]hex-4-enoate |
|---|---|
| PubChem CID | 54125558 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | benzyl 6-[(7R)-8-hydroxy-1,4-dioxaspiro[4.5]decan-7-yl]hex-4-enoate |
| SMILES | O=C(CCC=CC[C@@H]1CC2(CCC1O)OCCO2)OCc1ccccc1 |
| InChI | InChI=1S/C21H28O5/c22-19-11-12-21(25-13-14-26-21)15-18(19)9-5-2-6-10-20(23)24-16-17-7-3-1-4-8-17/h1-5,7-8,18-19,22H,6,9-16H2/t18-,19?/m1/s1 |
| InChIKey | NQSDFELMIGYOOY-MRTLOADZSA-N |
| XLogP | 3.36 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|