C6H12OS — CID 54129483
2,3-dimethylthiolane 1-oxide (PubChem CID 54129483) has the molecular formula C6H12OS and a molecular weight of 132.23 g/mol. Its IUPAC name is 2,3-dimethylthiolane 1-oxide.
| Compound Name | 2,3-dimethylthiolane 1-oxide |
|---|---|
| PubChem CID | 54129483 |
| Molecular Formula | C6H12OS |
| Molecular Weight | 132.23 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 2,3-dimethylthiolane 1-oxide |
| SMILES | CC1CCS(=O)C1C |
| InChI | InChI=1S/C6H12OS/c1-5-3-4-8(7)6(5)2/h5-6H,3-4H2,1-2H3 |
| InChIKey | NBKSQNXWHRUUFY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |