C6H13NOS — CID 95240880
(1S,2R,3R)-2,3-dimethyl-1,4-thiazinane 1-oxide (PubChem CID 95240880) has the molecular formula C6H13NOS and a molecular weight of 147.24 g/mol. Its IUPAC name is (1S,2R,3R)-2,3-dimethyl-1,4-thiazinane 1-oxide.
| Compound Name | (1S,2R,3R)-2,3-dimethyl-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 95240880 |
| Molecular Formula | C6H13NOS |
| Molecular Weight | 147.24 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | (1S,2R,3R)-2,3-dimethyl-1,4-thiazinane 1-oxide |
| SMILES | C[C@@H]1[C@@H](C)NCC[S@@]1=O |
| InChI | InChI=1S/C6H13NOS/c1-5-6(2)9(8)4-3-7-5/h5-7H,3-4H2,1-2H3/t5-,6-,9+/m1/s1 |
| InChIKey | JYHRQKWTPCFPJR-KCRUCZTKSA-N |
| XLogP | 0.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.24 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |