C30H42O4 — CID 54143289
4-(4-carboxyphenyl)-2,3-di(octan-2-yl)benzoic acid (PubChem CID 54143289) has the molecular formula C30H42O4 and a molecular weight of 466.66 g/mol. Its IUPAC name is 4-(4-carboxyphenyl)-2,3-di(octan-2-yl)benzoic acid.
| Compound Name | 4-(4-carboxyphenyl)-2,3-di(octan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 54143289 |
| Molecular Formula | C30H42O4 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | 4-(4-carboxyphenyl)-2,3-di(octan-2-yl)benzoic acid |
| SMILES | CCCCCCC(C)c1c(C(=O)O)ccc(-c2ccc(C(=O)O)cc2)c1C(C)CCCCCC |
| InChI | InChI=1S/C30H42O4/c1-5-7-9-11-13-21(3)27-25(23-15-17-24(18-16-23)29(31)32)19-20-26(30(33)34)28(27)22(4)14-12-10-8-6-2/h15-22H,5-14H2,1-4H3,(H,31,32)(H,33,34) |
| InChIKey | OCPBEAPJETUZJY-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|