4-(4-carboxyphenyl)-2,3-di(octan-2-yl)benzoic acid

C30H42O4 — CID 54143289

IUPAC4-(4-carboxyphenyl)-2,3-di(octan-2-yl)benzoic acid
SMILESCCCCCCC(C)c1c(C(=O)O)ccc(-c2ccc(C(=O)O)cc2)c1C(C)CCCCCC
InChIInChI=1S/C30H42O4/c1-5-7-9-11-13-21(3)27-25(23-15-17-24(18-16-23)29(31)32)19-20-26(30(33)34)28(27)22(4)14-12-10-8-6-2/h15-22H,5-14H2,1-4H3,(H,31,32)(H,33,34)
InChIKeyOCPBEAPJETUZJY-UHFFFAOYSA-N
MW466.66 g/mol
LogP8.90
Rot. Bonds15

About 4-(4-carboxyphenyl)-2,3-di(octan-2-yl)benzoic acid

4-(4-carboxyphenyl)-2,3-di(octan-2-yl)benzoic acid (PubChem CID 54143289) has the molecular formula C30H42O4 and a molecular weight of 466.66 g/mol. Its IUPAC name is 4-(4-carboxyphenyl)-2,3-di(octan-2-yl)benzoic acid.

Molecular Properties

Compound Name4-(4-carboxyphenyl)-2,3-di(octan-2-yl)benzoic acid
PubChem CID54143289
Molecular FormulaC30H42O4
Molecular Weight466.66 g/mol
Exact Mass466.31
IUPAC Name4-(4-carboxyphenyl)-2,3-di(octan-2-yl)benzoic acid
SMILESCCCCCCC(C)c1c(C(=O)O)ccc(-c2ccc(C(=O)O)cc2)c1C(C)CCCCCC
InChIInChI=1S/C30H42O4/c1-5-7-9-11-13-21(3)27-25(23-15-17-24(18-16-23)29(31)32)19-20-26(30(33)34)28(27)22(4)14-12-10-8-6-2/h15-22H,5-14H2,1-4H3,(H,31,32)(H,33,34)
InChIKeyOCPBEAPJETUZJY-UHFFFAOYSA-N
XLogP8.90
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds15
Heavy Atoms34
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500466.66
LogP ≤ 58.90
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-(4-carboxyphenyl)-2,3-di(octan-2-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4-carboxyphenyl)-2,3-di(octan-2-yl)benzoic acid?
The IUPAC name of 4-(4-carboxyphenyl)-2,3-di(octan-2-yl)benzoic acid (CID 54143289) is 4-(4-carboxyphenyl)-2,3-di(octan-2-yl)benzoic acid.
What is the SMILES notation for 4-(4-carboxyphenyl)-2,3-di(octan-2-yl)benzoic acid?
The canonical SMILES for 4-(4-carboxyphenyl)-2,3-di(octan-2-yl)benzoic acid is CCCCCCC(C)c1c(C(=O)O)ccc(-c2ccc(C(=O)O)cc2)c1C(C)CCCCCC.
What is the InChIKey of 4-(4-carboxyphenyl)-2,3-di(octan-2-yl)benzoic acid?
The InChIKey is OCPBEAPJETUZJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H42O4/c1-5-7-9-11-13-21(3)27-25(23-15-17-24(18-16-23)29(31)32)19-20-26(30(33)34)28(27)22(4)14-12-10-8-6-2/h15-22H,5-14H2,1-4H3,(H,31,32)(H,33,34).
What are the key properties of 4-(4-carboxyphenyl)-2,3-di(octan-2-yl)benzoic acid?
4-(4-carboxyphenyl)-2,3-di(octan-2-yl)benzoic acid has a molecular weight of 466.66 g/mol, XLogP of 8.90, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-carboxyphenyl)-2,3-di(octan-2-yl)benzoic acid is sourced from PubChem (CID 54143289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).