C14H19NO5 — CID 54144656
(2-methylpropan-2-yl)oxycarbonyl (2S)-1-(furan-2-yl)pyrrolidine-2-carboxylate (PubChem CID 54144656) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is (2-methylpropan-2-yl)oxycarbonyl (2S)-1-(furan-2-yl)pyrrolidine-2-carboxylate.
| Compound Name | (2-methylpropan-2-yl)oxycarbonyl (2S)-1-(furan-2-yl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 54144656 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | (2-methylpropan-2-yl)oxycarbonyl (2S)-1-(furan-2-yl)pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)OC(=O)[C@@H]1CCCN1c1ccco1 |
| InChI | InChI=1S/C14H19NO5/c1-14(2,3)20-13(17)19-12(16)10-6-4-8-15(10)11-7-5-9-18-11/h5,7,9-10H,4,6,8H2,1-3H3/t10-/m0/s1 |
| InChIKey | ODMRFEPDIFMJFI-JTQLQIEISA-N |
| XLogP | 2.73 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|