C8H4Cl2F4O — CID 54152778
1,3-dichloro-2-(1,1,2,2-tetrafluoroethoxy)benzene (PubChem CID 54152778) has the molecular formula C8H4Cl2F4O and a molecular weight of 263.02 g/mol. Its IUPAC name is 1,3-dichloro-2-(1,1,2,2-tetrafluoroethoxy)benzene.
| Compound Name | 1,3-dichloro-2-(1,1,2,2-tetrafluoroethoxy)benzene |
|---|---|
| PubChem CID | 54152778 |
| Molecular Formula | C8H4Cl2F4O |
| Molecular Weight | 263.02 g/mol |
| Exact Mass | 261.96 |
| IUPAC Name | 1,3-dichloro-2-(1,1,2,2-tetrafluoroethoxy)benzene |
| SMILES | FC(F)C(F)(F)Oc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H4Cl2F4O/c9-4-2-1-3-5(10)6(4)15-8(13,14)7(11)12/h1-3,7H |
| InChIKey | LUAWWNNPTWJVQX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.02 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|