C15H15NO2 — CID 54163595
2-benzyl-4,7-dihydroisoindole-1,3-diol (PubChem CID 54163595) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-benzyl-4,7-dihydroisoindole-1,3-diol.
| Compound Name | 2-benzyl-4,7-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54163595 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2-benzyl-4,7-dihydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1Cc1ccccc1)CC=CC2 |
| InChI | InChI=1S/C15H15NO2/c17-14-12-8-4-5-9-13(12)15(18)16(14)10-11-6-2-1-3-7-11/h1-7,17-18H,8-10H2 |
| InChIKey | OQCVPPDNCNFIOM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|