C19H22N2O3 — CID 54164818
1-but-2-enyl-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione (PubChem CID 54164818) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-but-2-enyl-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione.
| Compound Name | 1-but-2-enyl-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 54164818 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 1-but-2-enyl-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione |
| SMILES | CC=CCn1c(C(=O)c2cc(C)cc(C)c2)c(CC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H22N2O3/c1-5-7-8-21-16(15(6-2)18(23)20-19(21)24)17(22)14-10-12(3)9-13(4)11-14/h5,7,9-11H,6,8H2,1-4H3,(H,20,23,24) |
| InChIKey | OQXCKEHWZZWXMW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|