C16H9Cl2F3N4O3S2 — CID 54172672
1-[4-(2,6-dichloro-4-pyridinyl)-1,3-thiazol-2-yl]-3-[2-(trifluoromethyl)phenoxy]sulfinylurea (PubChem CID 54172672) has the molecular formula C16H9Cl2F3N4O3S2 and a molecular weight of 497.31 g/mol. Its IUPAC name is 1-[4-(2,6-dichloro-4-pyridinyl)-1,3-thiazol-2-yl]-3-[2-(trifluoromethyl)phenoxy]sulfinylurea.
| Compound Name | 1-[4-(2,6-dichloro-4-pyridinyl)-1,3-thiazol-2-yl]-3-[2-(trifluoromethyl)phenoxy]sulfinylurea |
|---|---|
| PubChem CID | 54172672 |
| Molecular Formula | C16H9Cl2F3N4O3S2 |
| Molecular Weight | 497.31 g/mol |
| Exact Mass | 495.94 |
| IUPAC Name | 1-[4-(2,6-dichloro-4-pyridinyl)-1,3-thiazol-2-yl]-3-[2-(trifluoromethyl)phenoxy]sulfinylurea |
| SMILES | O=C(Nc1nc(-c2cc(Cl)nc(Cl)c2)cs1)NS(=O)Oc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H9Cl2F3N4O3S2/c17-12-5-8(6-13(18)23-12)10-7-29-15(22-10)24-14(26)25-30(27)28-11-4-2-1-3-9(11)16(19,20)21/h1-7H,(H2,22,24,25,26) |
| InChIKey | UYGSSYGVYFZDOV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.31 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|