C24H21Cl2NO — CID 54202872
1-cyclopropylidene-1-(2,4-dichlorophenyl)-N-[(2-methyl-3-phenylphenyl)methoxy]methanamine (PubChem CID 54202872) has the molecular formula C24H21Cl2NO and a molecular weight of 410.34 g/mol. Its IUPAC name is 1-cyclopropylidene-1-(2,4-dichlorophenyl)-N-[(2-methyl-3-phenylphenyl)methoxy]methanamine.
| Compound Name | 1-cyclopropylidene-1-(2,4-dichlorophenyl)-N-[(2-methyl-3-phenylphenyl)methoxy]methanamine |
|---|---|
| PubChem CID | 54202872 |
| Molecular Formula | C24H21Cl2NO |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 1-cyclopropylidene-1-(2,4-dichlorophenyl)-N-[(2-methyl-3-phenylphenyl)methoxy]methanamine |
| SMILES | Cc1c(CONC(=C2CC2)c2ccc(Cl)cc2Cl)cccc1-c1ccccc1 |
| InChI | InChI=1S/C24H21Cl2NO/c1-16-19(8-5-9-21(16)17-6-3-2-4-7-17)15-28-27-24(18-10-11-18)22-13-12-20(25)14-23(22)26/h2-9,12-14,27H,10-11,15H2,1H3 |
| InChIKey | PQMCWFRQDAFTMW-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|