C25H23NO5S2 — CID 54209654
(2S)-1-[5-(1-benzothiophen-2-yl)-3-benzoylsulfanyl-5-oxopentanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 54209654) has the molecular formula C25H23NO5S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is (2S)-1-[5-(1-benzothiophen-2-yl)-3-benzoylsulfanyl-5-oxopentanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[5-(1-benzothiophen-2-yl)-3-benzoylsulfanyl-5-oxopentanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54209654 |
| Molecular Formula | C25H23NO5S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | (2S)-1-[5-(1-benzothiophen-2-yl)-3-benzoylsulfanyl-5-oxopentanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(SC(CC(=O)c1cc2ccccc2s1)CC(=O)N1CCC[C@H]1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C25H23NO5S2/c27-20(22-13-17-9-4-5-11-21(17)33-22)14-18(32-25(31)16-7-2-1-3-8-16)15-23(28)26-12-6-10-19(26)24(29)30/h1-5,7-9,11,13,18-19H,6,10,12,14-15H2,(H,29,30)/t18?,19-/m0/s1 |
| InChIKey | PVASVPPFSSLARN-GGYWPGCISA-N |
| XLogP | 4.88 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|