C24H40O6 — CID 54211296
methyl 7-[(8R,9R)-8-(6-methoxy-4,4-dimethylhex-1-enyl)-1,4-dioxaspiro[4.4]nonan-9-yl]-2-oxoheptanoate (PubChem CID 54211296) has the molecular formula C24H40O6 and a molecular weight of 424.58 g/mol. Its IUPAC name is methyl 7-[(8R,9R)-8-(6-methoxy-4,4-dimethylhex-1-enyl)-1,4-dioxaspiro[4.4]nonan-9-yl]-2-oxoheptanoate.
| Compound Name | methyl 7-[(8R,9R)-8-(6-methoxy-4,4-dimethylhex-1-enyl)-1,4-dioxaspiro[4.4]nonan-9-yl]-2-oxoheptanoate |
|---|---|
| PubChem CID | 54211296 |
| Molecular Formula | C24H40O6 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | methyl 7-[(8R,9R)-8-(6-methoxy-4,4-dimethylhex-1-enyl)-1,4-dioxaspiro[4.4]nonan-9-yl]-2-oxoheptanoate |
| SMILES | COCCC(C)(C)CC=C[C@H]1CCC2(OCCO2)[C@@H]1CCCCCC(=O)C(=O)OC |
| InChI | InChI=1S/C24H40O6/c1-23(2,15-16-27-3)13-8-9-19-12-14-24(29-17-18-30-24)20(19)10-6-5-7-11-21(25)22(26)28-4/h8-9,19-20H,5-7,10-18H2,1-4H3/t19-,20+/m0/s1 |
| InChIKey | PWDBBOKAQDBUIW-VQTJNVASSA-N |
| XLogP | 4.46 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|