C11H4ClN3O — CID 54211688
8-chloro-[1,3]oxazolo[4,5-h]quinoline-2-carbonitrile (PubChem CID 54211688) has the molecular formula C11H4ClN3O and a molecular weight of 229.63 g/mol. Its IUPAC name is 8-chloro-[1,3]oxazolo[4,5-h]quinoline-2-carbonitrile.
| Compound Name | 8-chloro-[1,3]oxazolo[4,5-h]quinoline-2-carbonitrile |
|---|---|
| PubChem CID | 54211688 |
| Molecular Formula | C11H4ClN3O |
| Molecular Weight | 229.63 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | 8-chloro-[1,3]oxazolo[4,5-h]quinoline-2-carbonitrile |
| SMILES | N#Cc1nc2ccc3ccc(Cl)nc3c2o1 |
| InChI | InChI=1S/C11H4ClN3O/c12-8-4-2-6-1-3-7-11(10(6)15-8)16-9(5-13)14-7/h1-4H |
| InChIKey | PWJOFECVSYJRPT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.63 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|