C19H17F3N2O2 — CID 54224991
5-amino-4-[3-methoxy-5-(trifluoromethyl)phenyl]-1-methyl-2-phenylpyrrol-3-ol (PubChem CID 54224991) has the molecular formula C19H17F3N2O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is 5-amino-4-[3-methoxy-5-(trifluoromethyl)phenyl]-1-methyl-2-phenylpyrrol-3-ol.
| Compound Name | 5-amino-4-[3-methoxy-5-(trifluoromethyl)phenyl]-1-methyl-2-phenylpyrrol-3-ol |
|---|---|
| PubChem CID | 54224991 |
| Molecular Formula | C19H17F3N2O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 5-amino-4-[3-methoxy-5-(trifluoromethyl)phenyl]-1-methyl-2-phenylpyrrol-3-ol |
| SMILES | COc1cc(-c2c(O)c(-c3ccccc3)n(C)c2N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17F3N2O2/c1-24-16(11-6-4-3-5-7-11)17(25)15(18(24)23)12-8-13(19(20,21)22)10-14(9-12)26-2/h3-10,25H,23H2,1-2H3 |
| InChIKey | QFFLLDALVGCFAB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |