C22H17ClF6O2 — CID 54237158
trans-(2,4,6-trifluoro-3-phenylphenyl)methyl (1R,3R)-3-(3-chloro-2,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 54237158) has the molecular formula C22H17ClF6O2 and a molecular weight of 462.82 g/mol. Its IUPAC name is trans-(2,4,6-trifluoro-3-phenylphenyl)methyl (1R,3R)-3-(3-chloro-2,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | trans-(2,4,6-trifluoro-3-phenylphenyl)methyl (1R,3R)-3-(3-chloro-2,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 54237158 |
| Molecular Formula | C22H17ClF6O2 |
| Molecular Weight | 462.82 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | trans-(2,4,6-trifluoro-3-phenylphenyl)methyl (1R,3R)-3-(3-chloro-2,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)OCc2c(F)cc(F)c(-c3ccccc3)c2F)[C@@H]1C=C(F)C(F)(F)Cl |
| InChI | InChI=1S/C22H17ClF6O2/c1-21(2)13(8-16(26)22(23,28)29)18(21)20(30)31-10-12-14(24)9-15(25)17(19(12)27)11-6-4-3-5-7-11/h3-9,13,18H,10H2,1-2H3/t13-,18-/m0/s1 |
| InChIKey | QNJKAMWUSXMNCX-UGSOOPFHSA-N |
| XLogP | 6.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.82 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|