C18H29NO — CID 54253350
2-(3,7-dimethyloct-6-enoxymethyl)-5-ethylpyridine (PubChem CID 54253350) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is 2-(3,7-dimethyloct-6-enoxymethyl)-5-ethylpyridine.
| Compound Name | 2-(3,7-dimethyloct-6-enoxymethyl)-5-ethylpyridine |
|---|---|
| PubChem CID | 54253350 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 2-(3,7-dimethyloct-6-enoxymethyl)-5-ethylpyridine |
| SMILES | CCc1ccc(COCCC(C)CCC=C(C)C)nc1 |
| InChI | InChI=1S/C18H29NO/c1-5-17-9-10-18(19-13-17)14-20-12-11-16(4)8-6-7-15(2)3/h7,9-10,13,16H,5-6,8,11-12,14H2,1-4H3 |
| InChIKey | QYHPXZKUASVMJK-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|