C21H22O5 — CID 54262561
5-[1-carboxy-3-(4-phenylphenyl)propoxy]pent-3-enoic acid (PubChem CID 54262561) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is 5-[1-carboxy-3-(4-phenylphenyl)propoxy]pent-3-enoic acid.
| Compound Name | 5-[1-carboxy-3-(4-phenylphenyl)propoxy]pent-3-enoic acid |
|---|---|
| PubChem CID | 54262561 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 5-[1-carboxy-3-(4-phenylphenyl)propoxy]pent-3-enoic acid |
| SMILES | O=C(O)CC=CCOC(CCc1ccc(-c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C21H22O5/c22-20(23)8-4-5-15-26-19(21(24)25)14-11-16-9-12-18(13-10-16)17-6-2-1-3-7-17/h1-7,9-10,12-13,19H,8,11,14-15H2,(H,22,23)(H,24,25) |
| InChIKey | RENSDPUKUSRXAB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|