C20H23NO6 — CID 54283446
(2R)-2-(4-isocyanato-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-2,3,4-trimethylhex-4-enoic acid (PubChem CID 54283446) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is (2R)-2-(4-isocyanato-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-2,3,4-trimethylhex-4-enoic acid.
| Compound Name | (2R)-2-(4-isocyanato-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-2,3,4-trimethylhex-4-enoic acid |
|---|---|
| PubChem CID | 54283446 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | (2R)-2-(4-isocyanato-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-2,3,4-trimethylhex-4-enoic acid |
| SMILES | CC=C(C)C(C)[C@@](C)(C(=O)O)c1c(N=C=O)c2c(c(C)c1OC)COC2=O |
| InChI | InChI=1S/C20H23NO6/c1-7-10(2)12(4)20(5,19(24)25)15-16(21-9-22)14-13(8-27-18(14)23)11(3)17(15)26-6/h7,12H,8H2,1-6H3,(H,24,25)/t12?,20-/m1/s1 |
| InChIKey | RSLCDRYHBIITED-VLFLDKFOSA-N |
| XLogP | 3.59 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|