C14H12N4O2 — CID 54284275
2-(3,4-dimethoxyphenyl)iminopropane-1,1,3-tricarbonitrile (PubChem CID 54284275) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)iminopropane-1,1,3-tricarbonitrile.
| Compound Name | 2-(3,4-dimethoxyphenyl)iminopropane-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 54284275 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)iminopropane-1,1,3-tricarbonitrile |
| SMILES | COc1ccc(/N=C(\CC#N)C(C#N)C#N)cc1OC |
| InChI | InChI=1S/C14H12N4O2/c1-19-13-4-3-11(7-14(13)20-2)18-12(5-6-15)10(8-16)9-17/h3-4,7,10H,5H2,1-2H3/b18-12+ |
| InChIKey | RSZODPZRRHGJAW-LDADJPATSA-N |
| XLogP | 2.35 |
| TPSA | 102.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|