C20H23N3O7S — CID 54292519
2-(2-amino-1,3-thiazol-4-yl)-2-[[2,2-dimethyl-6-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-benzodioxol-4-yl]methoxyimino]acetic acid (PubChem CID 54292519) has the molecular formula C20H23N3O7S and a molecular weight of 449.49 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-2-[[2,2-dimethyl-6-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-benzodioxol-4-yl]methoxyimino]acetic acid.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-2-[[2,2-dimethyl-6-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-benzodioxol-4-yl]methoxyimino]acetic acid |
|---|---|
| PubChem CID | 54292519 |
| Molecular Formula | C20H23N3O7S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-2-[[2,2-dimethyl-6-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-benzodioxol-4-yl]methoxyimino]acetic acid |
| SMILES | CC(C)(C)OC(=O)c1cc(CON=C(C(=O)O)c2csc(N)n2)c2c(c1)OC(C)(C)O2 |
| InChI | InChI=1S/C20H23N3O7S/c1-19(2,3)30-17(26)10-6-11(15-13(7-10)28-20(4,5)29-15)8-27-23-14(16(24)25)12-9-31-18(21)22-12/h6-7,9H,8H2,1-5H3,(H2,21,22)(H,24,25) |
| InChIKey | RYMZKGLLZWWLRH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 142.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|