C20H21Cl2NO7S2 — CID 54300942
2-[2-[(8,9-dichloro-7-methoxy-1,3,4,5-tetrahydro-2-benzothiepin-1-yl)methoxy]ethyl]-4-nitrobenzenesulfonic acid (PubChem CID 54300942) has the molecular formula C20H21Cl2NO7S2 and a molecular weight of 522.43 g/mol. Its IUPAC name is 2-[2-[(8,9-dichloro-7-methoxy-1,3,4,5-tetrahydro-2-benzothiepin-1-yl)methoxy]ethyl]-4-nitrobenzenesulfonic acid.
| Compound Name | 2-[2-[(8,9-dichloro-7-methoxy-1,3,4,5-tetrahydro-2-benzothiepin-1-yl)methoxy]ethyl]-4-nitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 54300942 |
| Molecular Formula | C20H21Cl2NO7S2 |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 521.01 |
| IUPAC Name | 2-[2-[(8,9-dichloro-7-methoxy-1,3,4,5-tetrahydro-2-benzothiepin-1-yl)methoxy]ethyl]-4-nitrobenzenesulfonic acid |
| SMILES | COc1cc2c(c(Cl)c1Cl)C(COCCc1cc([N+](=O)[O-])ccc1S(=O)(=O)O)SCCC2 |
| InChI | InChI=1S/C20H21Cl2NO7S2/c1-29-15-10-13-3-2-8-31-16(18(13)20(22)19(15)21)11-30-7-6-12-9-14(23(24)25)4-5-17(12)32(26,27)28/h4-5,9-10,16H,2-3,6-8,11H2,1H3,(H,26,27,28) |
| InChIKey | SECOONKSQJJGRS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|