C21H27NO9S2 — CID 88744508
2-[(6,7-dimethoxy-1-methyl-3,4-dihydroisothiochromen-1-yl)methoxy]ethanol;4-nitrobenzenesulfonic acid (PubChem CID 88744508) has the molecular formula C21H27NO9S2 and a molecular weight of 501.58 g/mol. Its IUPAC name is 2-[(6,7-dimethoxy-1-methyl-3,4-dihydroisothiochromen-1-yl)methoxy]ethanol;4-nitrobenzenesulfonic acid.
| Compound Name | 2-[(6,7-dimethoxy-1-methyl-3,4-dihydroisothiochromen-1-yl)methoxy]ethanol;4-nitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 88744508 |
| Molecular Formula | C21H27NO9S2 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | 2-[(6,7-dimethoxy-1-methyl-3,4-dihydroisothiochromen-1-yl)methoxy]ethanol;4-nitrobenzenesulfonic acid |
| SMILES | COc1cc2c(cc1OC)C(C)(COCCO)SCC2.O=[N+]([O-])c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C15H22O4S.C6H5NO5S/c1-15(10-19-6-5-16)12-9-14(18-3)13(17-2)8-11(12)4-7-20-15;8-7(9)5-1-3-6(4-2-5)13(10,11)12/h8-9,16H,4-7,10H2,1-3H3;1-4H,(H,10,11,12) |
| InChIKey | ASVHDBRYOJRLML-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 145.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|