C23H29NO11S — CID 54373179
4-nitro-2-[2-[(4,5,7,9-tetramethoxy-1,3,4,5-tetrahydro-2-benzoxepin-1-yl)methoxy]ethyl]benzenesulfonic acid (PubChem CID 54373179) has the molecular formula C23H29NO11S and a molecular weight of 527.55 g/mol. Its IUPAC name is 4-nitro-2-[2-[(4,5,7,9-tetramethoxy-1,3,4,5-tetrahydro-2-benzoxepin-1-yl)methoxy]ethyl]benzenesulfonic acid.
| Compound Name | 4-nitro-2-[2-[(4,5,7,9-tetramethoxy-1,3,4,5-tetrahydro-2-benzoxepin-1-yl)methoxy]ethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 54373179 |
| Molecular Formula | C23H29NO11S |
| Molecular Weight | 527.55 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | 4-nitro-2-[2-[(4,5,7,9-tetramethoxy-1,3,4,5-tetrahydro-2-benzoxepin-1-yl)methoxy]ethyl]benzenesulfonic acid |
| SMILES | COc1cc(OC)c2c(c1)C(OC)C(OC)COC2COCCc1cc([N+](=O)[O-])ccc1S(=O)(=O)O |
| InChI | InChI=1S/C23H29NO11S/c1-30-16-10-17-22(18(11-16)31-2)19(35-13-20(32-3)23(17)33-4)12-34-8-7-14-9-15(24(25)26)5-6-21(14)36(27,28)29/h5-6,9-11,19-20,23H,7-8,12-13H2,1-4H3,(H,27,28,29) |
| InChIKey | UUQTUKJYVJSKLN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 152.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|