C18H11F4N5O3 — CID 54316679
(2R)-2-amino-3-(4-azido-2,3,5,6-tetrafluorophenyl)-2-(1H-indol-3-ylmethyl)-3-oxopropanoic acid (PubChem CID 54316679) has the molecular formula C18H11F4N5O3 and a molecular weight of 421.31 g/mol. Its IUPAC name is (2R)-2-amino-3-(4-azido-2,3,5,6-tetrafluorophenyl)-2-(1H-indol-3-ylmethyl)-3-oxopropanoic acid.
| Compound Name | (2R)-2-amino-3-(4-azido-2,3,5,6-tetrafluorophenyl)-2-(1H-indol-3-ylmethyl)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 54316679 |
| Molecular Formula | C18H11F4N5O3 |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | (2R)-2-amino-3-(4-azido-2,3,5,6-tetrafluorophenyl)-2-(1H-indol-3-ylmethyl)-3-oxopropanoic acid |
| SMILES | [N-]=[N+]=Nc1c(F)c(F)c(C(=O)[C@](N)(Cc2c[nH]c3ccccc23)C(=O)O)c(F)c1F |
| InChI | InChI=1S/C18H11F4N5O3/c19-11-10(12(20)14(22)15(13(11)21)26-27-24)16(28)18(23,17(29)30)5-7-6-25-9-4-2-1-3-8(7)9/h1-4,6,25H,5,23H2,(H,29,30)/t18-/m1/s1 |
| InChIKey | SORUZHJBBPVYCH-GOSISDBHSA-N |
| XLogP | 3.87 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|