C21H31N3O4 — CID 5431767
N-[(Z)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-4-tert-butylcyclohexane-1-carboxamide (PubChem CID 5431767) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is N-[(Z)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-4-tert-butylcyclohexane-1-carboxamide.
| Compound Name | N-[(Z)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-4-tert-butylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 5431767 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | N-[(Z)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-4-tert-butylcyclohexane-1-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)C2CCC(C(C)(C)C)CC2)ccc1OCC(N)=O |
| InChI | InChI=1S/C21H31N3O4/c1-21(2,3)16-8-6-15(7-9-16)20(26)24-23-12-14-5-10-17(18(11-14)27-4)28-13-19(22)25/h5,10-12,15-16H,6-9,13H2,1-4H3,(H2,22,25)(H,24,26)/b23-12- |
| InChIKey | UHTRWBPKHZALEH-FMCGGJTJSA-N |
| XLogP | 2.86 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|