C24H42O5 — CID 54336157
4-[1-methoxy-5,5-dimethyl-3-(oxan-2-yloxy)non-2-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 54336157) has the molecular formula C24H42O5 and a molecular weight of 410.60 g/mol. Its IUPAC name is 4-[1-methoxy-5,5-dimethyl-3-(oxan-2-yloxy)non-2-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | 4-[1-methoxy-5,5-dimethyl-3-(oxan-2-yloxy)non-2-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 54336157 |
| Molecular Formula | C24H42O5 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | 4-[1-methoxy-5,5-dimethyl-3-(oxan-2-yloxy)non-2-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CCCCC(C)(C)CC(=CC(OC)C1CCC2OC(O)CC21)OC1CCCCO1 |
| InChI | InChI=1S/C24H42O5/c1-5-6-12-24(2,3)16-17(28-23-9-7-8-13-27-23)14-21(26-4)18-10-11-20-19(18)15-22(25)29-20/h14,18-23,25H,5-13,15-16H2,1-4H3 |
| InChIKey | TVPSOTOZKZGXPM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|