C17H18N5O6P — CID 54357590
2-[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethenyl-phenoxyphosphinic acid (PubChem CID 54357590) has the molecular formula C17H18N5O6P and a molecular weight of 419.33 g/mol. Its IUPAC name is 2-[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethenyl-phenoxyphosphinic acid.
| Compound Name | 2-[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethenyl-phenoxyphosphinic acid |
|---|---|
| PubChem CID | 54357590 |
| Molecular Formula | C17H18N5O6P |
| Molecular Weight | 419.33 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 2-[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethenyl-phenoxyphosphinic acid |
| SMILES | Cc1cn(C2CC(N=[N+]=[N-])C(C=CP(=O)(O)Oc3ccccc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H18N5O6P/c1-11-10-22(17(24)19-16(11)23)15-9-13(20-21-18)14(27-15)7-8-29(25,26)28-12-5-3-2-4-6-12/h2-8,10,13-15H,9H2,1H3,(H,25,26)(H,19,23,24) |
| InChIKey | UKEWTKWMSKHTON-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 159.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|