C12H14N6O6 — CID 165352355
2-[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methylideneamino]oxyacetic acid (PubChem CID 165352355) has the molecular formula C12H14N6O6 and a molecular weight of 338.28 g/mol. Its IUPAC name is 2-[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methylideneamino]oxyacetic acid.
| Compound Name | 2-[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 165352355 |
| Molecular Formula | C12H14N6O6 |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 2-[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methylideneamino]oxyacetic acid |
| SMILES | Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](C=NOCC(=O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H14N6O6/c1-6-4-18(12(22)15-11(6)21)9-2-7(16-17-13)8(24-9)3-14-23-5-10(19)20/h3-4,7-9H,2,5H2,1H3,(H,19,20)(H,15,21,22)/t7-,8+,9+/m0/s1 |
| InChIKey | HXERFEBLHBKDSH-DJLDLDEBSA-N |
| XLogP | -0.10 |
| TPSA | 171.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|