C15H22N2O4 — CID 54364204
1-[7-(2,5-dihydroxypyrrol-1-yl)heptyl]pyrrole-2,5-diol (PubChem CID 54364204) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 1-[7-(2,5-dihydroxypyrrol-1-yl)heptyl]pyrrole-2,5-diol.
| Compound Name | 1-[7-(2,5-dihydroxypyrrol-1-yl)heptyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 54364204 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 1-[7-(2,5-dihydroxypyrrol-1-yl)heptyl]pyrrole-2,5-diol |
| SMILES | Oc1ccc(O)n1CCCCCCCn1c(O)ccc1O |
| InChI | InChI=1S/C15H22N2O4/c18-12-6-7-13(19)16(12)10-4-2-1-3-5-11-17-14(20)8-9-15(17)21/h6-9,18-21H,1-5,10-11H2 |
| InChIKey | UOPQUFHLYUCILV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 90.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|