C28H32Cl2N6OS — CID 54387174
1-[4-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-2,2-dimethyl-3-oxobutyl]-1-[(2,3-dichlorophenyl)methylamino]-3-propylthiourea (PubChem CID 54387174) has the molecular formula C28H32Cl2N6OS and a molecular weight of 571.58 g/mol. Its IUPAC name is 1-[4-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-2,2-dimethyl-3-oxobutyl]-1-[(2,3-dichlorophenyl)methylamino]-3-propylthiourea.
| Compound Name | 1-[4-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-2,2-dimethyl-3-oxobutyl]-1-[(2,3-dichlorophenyl)methylamino]-3-propylthiourea |
|---|---|
| PubChem CID | 54387174 |
| Molecular Formula | C28H32Cl2N6OS |
| Molecular Weight | 571.58 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | 1-[4-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]-2,2-dimethyl-3-oxobutyl]-1-[(2,3-dichlorophenyl)methylamino]-3-propylthiourea |
| SMILES | CCCNC(=S)N(CC(C)(C)C(=O)Cc1cncn1Cc1ccc(C#N)cc1)NCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C28H32Cl2N6OS/c1-4-12-33-27(38)36(34-15-22-6-5-7-24(29)26(22)30)18-28(2,3)25(37)13-23-16-32-19-35(23)17-21-10-8-20(14-31)9-11-21/h5-11,16,19,34H,4,12-13,15,17-18H2,1-3H3,(H,33,38) |
| InChIKey | VEAZMSNWXDVITD-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 85.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.58 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|