C19H20Cl2N2O6S — CID 54392425
[2,3-diacetyloxy-4-(5,6-dichloro-2-sulfanylidene-3H-benzimidazol-1-yl)cyclopentyl]methyl acetate (PubChem CID 54392425) has the molecular formula C19H20Cl2N2O6S and a molecular weight of 475.35 g/mol. Its IUPAC name is [2,3-diacetyloxy-4-(5,6-dichloro-2-sulfanylidene-3H-benzimidazol-1-yl)cyclopentyl]methyl acetate.
| Compound Name | [2,3-diacetyloxy-4-(5,6-dichloro-2-sulfanylidene-3H-benzimidazol-1-yl)cyclopentyl]methyl acetate |
|---|---|
| PubChem CID | 54392425 |
| Molecular Formula | C19H20Cl2N2O6S |
| Molecular Weight | 475.35 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | [2,3-diacetyloxy-4-(5,6-dichloro-2-sulfanylidene-3H-benzimidazol-1-yl)cyclopentyl]methyl acetate |
| SMILES | CC(=O)OCC1CC(n2c(=S)[nH]c3cc(Cl)c(Cl)cc32)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C19H20Cl2N2O6S/c1-8(24)27-7-11-4-16(18(29-10(3)26)17(11)28-9(2)25)23-15-6-13(21)12(20)5-14(15)22-19(23)30/h5-6,11,16-18H,4,7H2,1-3H3,(H,22,30) |
| InChIKey | VHPILVYTHVFHGH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|